C27H36ClN11O — CID 58949351
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-chloro-5-methylphenyl]benzamide (PubChem CID 58949351) has the molecular formula C27H36ClN11O and a molecular weight of 566.11 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-chloro-5-methylphenyl]benzamide.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-chloro-5-methylphenyl]benzamide |
|---|---|
| PubChem CID | 58949351 |
| Molecular Formula | C27H36ClN11O |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-chloro-5-methylphenyl]benzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2)c(Cl)cc1Nc1nc(N2C[C@H](N)C[C@H](N)C2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C27H36ClN11O/c1-15-7-23(33-24(40)16-5-3-2-4-6-16)21(28)10-22(15)34-25-35-26(38-11-17(29)8-18(30)12-38)37-27(36-25)39-13-19(31)9-20(32)14-39/h2-7,10,17-20H,8-9,11-14,29-32H2,1H3,(H,33,40)(H,34,35,36,37)/t17-,18+,19-,20+ |
| InChIKey | ZCNGRSALOCCACO-FGYAAKKASA-N |
| XLogP | 1.56 |
| TPSA | 190.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |