C13H22BrN3O2 — CID 58958595
tert-butyl N-(4-bromo-3-tert-butyl-1-methylpyrazol-5-yl)carbamate (PubChem CID 58958595) has the molecular formula C13H22BrN3O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-3-tert-butyl-1-methylpyrazol-5-yl)carbamate.
| Compound Name | tert-butyl N-(4-bromo-3-tert-butyl-1-methylpyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 58958595 |
| Molecular Formula | C13H22BrN3O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | tert-butyl N-(4-bromo-3-tert-butyl-1-methylpyrazol-5-yl)carbamate |
| SMILES | Cn1nc(C(C)(C)C)c(Br)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22BrN3O2/c1-12(2,3)9-8(14)10(17(7)16-9)15-11(18)19-13(4,5)6/h1-7H3,(H,15,18) |
| InChIKey | MJQWOPWUXJQUCG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |