C16H26P2Y-2 — CID 59017162
1-[3-(2,5-dimethylphospholan-1-yl)-1,4-ditritiobuta-1,3-dien-2-yl]-2,5-dimethylphospholane;yttrium (PubChem CID 59017162) has the molecular formula C16H26P2Y-2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylphospholan-1-yl)-1,4-ditritiobuta-1,3-dien-2-yl]-2,5-dimethylphospholane;yttrium.
| Compound Name | 1-[3-(2,5-dimethylphospholan-1-yl)-1,4-ditritiobuta-1,3-dien-2-yl]-2,5-dimethylphospholane;yttrium |
|---|---|
| PubChem CID | 59017162 |
| Molecular Formula | C16H26P2Y-2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-[3-(2,5-dimethylphospholan-1-yl)-1,4-ditritiobuta-1,3-dien-2-yl]-2,5-dimethylphospholane;yttrium |
| SMILES | [3H]/[C-]=C(C(=[C-]/[3H])/P1C(C)CCC1C)\P1C(C)CCC1C.[Y] |
| InChI | InChI=1S/C16H26P2.Y/c1-11-7-8-12(2)17(11)15(5)16(6)18-13(3)9-10-14(18)4;/h5-6,11-14H,7-10H2,1-4H3;/q-2;/i5T,6T; |
| InChIKey | SXVBBPGYHKKRGP-JEJBHRHBSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|