C34H42NO5PSi — CID 59042147
(4S)-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-4-(phosphanylmethyl)-1,3-oxazolidin-2-one (PubChem CID 59042147) has the molecular formula C34H42NO5PSi and a molecular weight of 603.77 g/mol. Its IUPAC name is (4S)-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-4-(phosphanylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-4-(phosphanylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59042147 |
| Molecular Formula | C34H42NO5PSi |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | (4S)-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-4-(phosphanylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCC[C@@H](C(=O)N1C(=O)OC[C@H]1CP)[C@@H](O)/C=C\c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H42NO5PSi/c1-34(2,3)42(28-16-9-5-10-17-28,29-18-11-6-12-19-29)40-23-13-20-30(31(36)22-21-26-14-7-4-8-15-26)32(37)35-27(25-41)24-39-33(35)38/h4-12,14-19,21-22,27,30-31,36H,13,20,23-25,41H2,1-3H3/b22-21-/t27-,30+,31-/m0/s1 |
| InChIKey | OCDHIXGMTVSMTP-AKSKAREUSA-N |
| XLogP | 5.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|