C28H24ClN5O3 — CID 59092119
3-chloro-4-hydroxy-N-[(E)-[1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 59092119) has the molecular formula C28H24ClN5O3 and a molecular weight of 513.99 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(E)-[1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(E)-[1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 59092119 |
| Molecular Formula | C28H24ClN5O3 |
| Molecular Weight | 513.99 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(E)-[1-[2-[2-(1H-indol-3-yl)ethylamino]-2-oxoethyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | O=C(Cn1cc(/C=N/NC(=O)c2ccc(O)c(Cl)c2)c2ccccc21)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H24ClN5O3/c29-23-13-18(9-10-26(23)35)28(37)33-32-15-20-16-34(25-8-4-2-6-22(20)25)17-27(36)30-12-11-19-14-31-24-7-3-1-5-21(19)24/h1-10,13-16,31,35H,11-12,17H2,(H,30,36)(H,33,37)/b32-15+ |
| InChIKey | SNXMAIYWMXTYAH-VWJSQJICSA-N |
| XLogP | 4.60 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|