C26H23ClN4O3 — CID 72513951
3-chloro-4-hydroxy-N-[[1-[2-oxo-2-(2-phenylethylamino)ethyl]indol-3-yl]methylideneamino]benzamide (PubChem CID 72513951) has the molecular formula C26H23ClN4O3 and a molecular weight of 474.95 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[[1-[2-oxo-2-(2-phenylethylamino)ethyl]indol-3-yl]methylideneamino]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[[1-[2-oxo-2-(2-phenylethylamino)ethyl]indol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 72513951 |
| Molecular Formula | C26H23ClN4O3 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[[1-[2-oxo-2-(2-phenylethylamino)ethyl]indol-3-yl]methylideneamino]benzamide |
| SMILES | O=C(Cn1cc(C=NNC(=O)c2ccc(O)c(Cl)c2)c2ccccc21)NCCc1ccccc1 |
| InChI | InChI=1S/C26H23ClN4O3/c27-22-14-19(10-11-24(22)32)26(34)30-29-15-20-16-31(23-9-5-4-8-21(20)23)17-25(33)28-13-12-18-6-2-1-3-7-18/h1-11,14-16,32H,12-13,17H2,(H,28,33)(H,30,34) |
| InChIKey | ZGJCEMHBPILENJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|