C11H28N3O4P5 — CID 59101078
bis(phosphanyl)phosphanyl 6-(diphosphanylamino)-2-[[(2S)-3-methoxy-2-(methylamino)propanoyl]amino]hexanoate (PubChem CID 59101078) has the molecular formula C11H28N3O4P5 and a molecular weight of 421.23 g/mol. Its IUPAC name is bis(phosphanyl)phosphanyl 6-(diphosphanylamino)-2-[[(2S)-3-methoxy-2-(methylamino)propanoyl]amino]hexanoate.
| Compound Name | bis(phosphanyl)phosphanyl 6-(diphosphanylamino)-2-[[(2S)-3-methoxy-2-(methylamino)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 59101078 |
| Molecular Formula | C11H28N3O4P5 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | bis(phosphanyl)phosphanyl 6-(diphosphanylamino)-2-[[(2S)-3-methoxy-2-(methylamino)propanoyl]amino]hexanoate |
| SMILES | CN[C@@H](COC)C(=O)NC(CCCCNPP)C(=O)OP(P)P |
| InChI | InChI=1S/C11H28N3O4P5/c1-12-9(7-17-2)10(15)14-8(11(16)18-23(20)21)5-3-4-6-13-22-19/h8-9,12-13,22H,3-7,19-21H2,1-2H3,(H,14,15)/t8?,9-/m0/s1 |
| InChIKey | VKOXNMNZYSDTGY-GKAPJAKFSA-N |
| XLogP | 1.37 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|