C31H51O- — CID 59271588
8a-butyl-2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-4,8-dihydro-3H-chromene (PubChem CID 59271588) has the molecular formula C31H51O- and a molecular weight of 439.75 g/mol. Its IUPAC name is 8a-butyl-2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-4,8-dihydro-3H-chromene.
| Compound Name | 8a-butyl-2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-4,8-dihydro-3H-chromene |
|---|---|
| PubChem CID | 59271588 |
| Molecular Formula | C31H51O- |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 439.39 |
| IUPAC Name | 8a-butyl-2-[(3E,8E)-4,8-dimethyltrideca-3,8-dienyl]-2,7,8-trimethyl-4,8-dihydro-3H-chromene |
| SMILES | C[CH-]CC/C=C(\C)CCC/C(C)=C/CCC1(C)CCC2=CC=C(C)C(C)C2(CCCC)O1 |
| InChI | InChI=1S/C31H51O/c1-8-10-12-15-25(3)16-13-17-26(4)18-14-22-30(7)24-21-29-20-19-27(5)28(6)31(29,32-30)23-11-9-2/h8,15,18-20,28H,9-14,16-17,21-24H2,1-7H3/q-1/b25-15+,26-18+ |
| InChIKey | JEEKVZHZQVCXOX-CQKXQQKSSA-N |
| XLogP | 9.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|