C20H28F3N3O3S2 — CID 59384358
(2S)-2-amino-2-[5-[4-octylsulfonyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol (PubChem CID 59384358) has the molecular formula C20H28F3N3O3S2 and a molecular weight of 479.59 g/mol. Its IUPAC name is (2S)-2-amino-2-[5-[4-octylsulfonyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[5-[4-octylsulfonyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 59384358 |
| Molecular Formula | C20H28F3N3O3S2 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (2S)-2-amino-2-[5-[4-octylsulfonyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]propan-1-ol |
| SMILES | CCCCCCCCS(=O)(=O)c1ccc(-c2nnc([C@@](C)(N)CO)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H28F3N3O3S2/c1-3-4-5-6-7-8-11-31(28,29)16-10-9-14(12-15(16)20(21,22)23)17-25-26-18(30-17)19(2,24)13-27/h9-10,12,27H,3-8,11,13,24H2,1-2H3/t19-/m0/s1 |
| InChIKey | AESRUKFSHXKRKJ-IBGZPJMESA-N |
| XLogP | 4.52 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|