C9H11F2O3S- — CID 59409326
2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonate (PubChem CID 59409326) has the molecular formula C9H11F2O3S- and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonate.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 59409326 |
| Molecular Formula | C9H11F2O3S- |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-difluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C9H12F2O3S/c10-9(11,15(12,13)14)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,12,13,14)/p-1 |
| InChIKey | HPPTXRKEBRSGGO-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|