C11H11F6O3S- — CID 59409352
2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate (PubChem CID 59409352) has the molecular formula C11H11F6O3S- and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 59409352 |
| Molecular Formula | C11H11F6O3S- |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate |
| SMILES | O=S(=O)([O-])C(CC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O3S/c12-10(13,14)9(11(15,16)17,21(18,19)20)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2,(H,18,19,20)/p-1 |
| InChIKey | BWQDNEUPNCNYDF-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|