About 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene
12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene (PubChem CID 59518927) has the molecular formula C10H10OS
and a molecular weight of 178.26 g/mol. Its IUPAC name is 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene.
Analyze 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene?
The IUPAC name of 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene (CID 59518927) is 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene.
What is the SMILES notation for 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene?
The canonical SMILES for 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene is c1ccc2c(c1)C1CSCC2O1.
What is the InChIKey of 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene?
The InChIKey is VEHWSPJQTWNNJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10OS/c1-2-4-8-7(3-1)9-5-12-6-10(8)11-9/h1-4,9-10H,5-6H2.
What are the key properties of 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene?
12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene has a molecular weight of 178.26 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-oxa-10-thiatricyclo[6.3.1.02,7]dodeca-2,4,6-triene is sourced from PubChem (CID 59518927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).