C33H51N5O4 — CID 59624265
[(4aS,6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[[2-[[2-amino-5-(1-aminoethylideneamino)pentanoyl]amino]acetyl]amino]acetate (PubChem CID 59624265) has the molecular formula C33H51N5O4 and a molecular weight of 581.80 g/mol. Its IUPAC name is [(4aS,6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[[2-[[2-amino-5-(1-aminoethylideneamino)pentanoyl]amino]acetyl]amino]acetate.
| Compound Name | [(4aS,6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[[2-[[2-amino-5-(1-aminoethylideneamino)pentanoyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 59624265 |
| Molecular Formula | C33H51N5O4 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | [(4aS,6aR,11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[[2-[[2-amino-5-(1-aminoethylideneamino)pentanoyl]amino]acetyl]amino]acetate |
| SMILES | C/C(N)=N\CCCC(N)C(=O)NCC(=O)NCC(=O)Oc1cc(C)c2c(c1)C[C@@H]1[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C33H51N5O4/c1-20-15-23(42-28(40)19-37-27(39)18-38-30(41)24(35)9-7-14-36-21(2)34)16-22-17-26-32(5)12-8-11-31(3,4)25(32)10-13-33(26,6)29(20)22/h15-16,24-26H,7-14,17-19,35H2,1-6H3,(H2,34,36)(H,37,39)(H,38,41)/t24?,25-,26+,32-,33+/m0/s1 |
| InChIKey | LWHMODVJAHQMJM-OXAFOLIMSA-N |
| XLogP | 3.67 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|