C17H40N6O2 — CID 59798974
tert-butyl N-[5-(2-aminoethylamino)-6-[bis(2-aminoethyl)amino]hexyl]carbamate (PubChem CID 59798974) has the molecular formula C17H40N6O2 and a molecular weight of 360.55 g/mol. Its IUPAC name is tert-butyl N-[5-(2-aminoethylamino)-6-[bis(2-aminoethyl)amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[5-(2-aminoethylamino)-6-[bis(2-aminoethyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 59798974 |
| Molecular Formula | C17H40N6O2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | tert-butyl N-[5-(2-aminoethylamino)-6-[bis(2-aminoethyl)amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(CN(CCN)CCN)NCCN |
| InChI | InChI=1S/C17H40N6O2/c1-17(2,3)25-16(24)22-10-5-4-6-15(21-11-7-18)14-23(12-8-19)13-9-20/h15,21H,4-14,18-20H2,1-3H3,(H,22,24) |
| InChIKey | FMPVJGOCMBZFSU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|