C36H47O2W- — CID 59872030
ethanol;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethylbenzene-4-id-1-yl)phenyl]ethynyl]benzene;tungsten (PubChem CID 59872030) has the molecular formula C36H47O2W- and a molecular weight of 695.61 g/mol. Its IUPAC name is ethanol;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethylbenzene-4-id-1-yl)phenyl]ethynyl]benzene;tungsten.
| Compound Name | ethanol;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethylbenzene-4-id-1-yl)phenyl]ethynyl]benzene;tungsten |
|---|---|
| PubChem CID | 59872030 |
| Molecular Formula | C36H47O2W- |
| Molecular Weight | 695.61 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | ethanol;1-ethoxy-2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethylbenzene-4-id-1-yl)phenyl]ethynyl]benzene;tungsten |
| SMILES | CCO.CCOc1c(C)c(C)c(C#Cc2c(C)c(C)c(-c3c(C)c(C)[c-]c(C)c3C)c(C)c2C)c(C)c1C.[W] |
| InChI | InChI=1S/C34H41O.C2H6O.W/c1-14-35-34-28(12)24(8)31(25(9)29(34)13)16-15-30-22(6)26(10)33(27(11)23(30)7)32-20(4)18(2)17-19(3)21(32)5;1-2-3;/h14H2,1-13H3;3H,2H2,1H3;/q-1;; |
| InChIKey | FYQBXQYIICNSMU-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.61 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|