C17H27N2+ — CID 59893824
3-tert-butyl-1,2,4,5,6,7-hexamethylpyrrolo[2,3-b]pyridin-7-ium (PubChem CID 59893824) has the molecular formula C17H27N2+ and a molecular weight of 259.42 g/mol. Its IUPAC name is 3-tert-butyl-1,2,4,5,6,7-hexamethylpyrrolo[2,3-b]pyridin-7-ium.
| Compound Name | 3-tert-butyl-1,2,4,5,6,7-hexamethylpyrrolo[2,3-b]pyridin-7-ium |
|---|---|
| PubChem CID | 59893824 |
| Molecular Formula | C17H27N2+ |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | 3-tert-butyl-1,2,4,5,6,7-hexamethylpyrrolo[2,3-b]pyridin-7-ium |
| SMILES | Cc1c(C)c2c(C(C)(C)C)c(C)n(C)c2[n+](C)c1C |
| InChI | InChI=1S/C17H27N2/c1-10-11(2)14-15(17(5,6)7)13(4)19(9)16(14)18(8)12(10)3/h1-9H3/q+1 |
| InChIKey | QPZGXIYVVPTHFG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|