C15H18N — CID 59914822
CID 59914822 (PubChem CID 59914822) has the molecular formula C15H18N and a molecular weight of 212.32 g/mol.
| Compound Name | CID 59914822 |
|---|---|
| PubChem CID | 59914822 |
| Molecular Formula | C15H18N |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | — |
| SMILES | C/N=C1\CCc2ccccc2C2[CH]CCC12 |
| InChI | InChI=1S/C15H18N/c1-16-15-10-9-11-5-2-3-6-12(11)13-7-4-8-14(13)15/h2-3,5-7,13-14H,4,8-10H2,1H3/b16-15+ |
| InChIKey | KVJUTMGATLRDCQ-FOCLMDBBSA-N |
| XLogP | 3.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|