C18H14Y-2 — CID 59915148
4,5-dimethyl-8-phenyl-1H-naphthalen-1-ide;yttrium (PubChem CID 59915148) has the molecular formula C18H14Y-2 and a molecular weight of 319.22 g/mol. Its IUPAC name is 4,5-dimethyl-8-phenyl-1H-naphthalen-1-ide;yttrium.
| Compound Name | 4,5-dimethyl-8-phenyl-1H-naphthalen-1-ide;yttrium |
|---|---|
| PubChem CID | 59915148 |
| Molecular Formula | C18H14Y-2 |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4,5-dimethyl-8-phenyl-1H-naphthalen-1-ide;yttrium |
| SMILES | Cc1cc[c-]c2c(-c3[c-]cccc3)ccc(C)c12.[Y] |
| InChI | InChI=1S/C18H14.Y/c1-13-7-6-10-17-16(12-11-14(2)18(13)17)15-8-4-3-5-9-15;/h3-8,11-12H,1-2H3;/q-2; |
| InChIKey | FPHWPSMXYUAMDX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|