C23H39F17O5Si4 — CID 59944633
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944633) has the molecular formula C23H39F17O5Si4 and a molecular weight of 830.87 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944633 |
| Molecular Formula | C23H39F17O5Si4 |
| Molecular Weight | 830.87 g/mol |
| Exact Mass | 830.16 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C23H39F17O5Si4/c1-46(2,3)43-48(6,7)45-49(8,44-47(4,5)13-9-11-41)14-10-12-42-15-16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)21(34,35)22(36,37)23(38,39)40/h41H,9-15H2,1-8H3 |
| InChIKey | CKRONIUVGQHVNY-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.87 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|