C8H15N — CID 59960431
CID 59960431 (PubChem CID 59960431) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol.
| Compound Name | CID 59960431 |
|---|---|
| PubChem CID | 59960431 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | — |
| SMILES | [CH]C(C)N(CC)C([CH])C |
| InChI | InChI=1S/C8H15N/c1-6-9(7(2)3)8(4)5/h2,4,7-8H,6H2,1,3,5H3 |
| InChIKey | DWAJFUQMPFEEFP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |