C25H34N2O4 — CID 59990884
(7R,8S)-2-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-(piperidine-1-carbonyl)-6,7-dihydro-5H-pyrrolizin-3-one (PubChem CID 59990884) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is (7R,8S)-2-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-(piperidine-1-carbonyl)-6,7-dihydro-5H-pyrrolizin-3-one.
| Compound Name | (7R,8S)-2-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-(piperidine-1-carbonyl)-6,7-dihydro-5H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 59990884 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (7R,8S)-2-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-7-(piperidine-1-carbonyl)-6,7-dihydro-5H-pyrrolizin-3-one |
| SMILES | C[C@H]1C=C[C@H]2CCCC[C@@H]2C1C(=O)C1=C[C@]2(O)[C@H](C(=O)N3CCCCC3)CCN2C1=O |
| InChI | InChI=1S/C25H34N2O4/c1-16-9-10-17-7-3-4-8-18(17)21(16)22(28)19-15-25(31)20(11-14-27(25)23(19)29)24(30)26-12-5-2-6-13-26/h9-10,15-18,20-21,31H,2-8,11-14H2,1H3/t16-,17+,18-,20-,21?,25-/m0/s1 |
| InChIKey | BNMJJLTZWXOJOZ-ZVLMPQBMSA-N |
| XLogP | 2.67 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|