C26H38N2O4 — CID 59990899
(1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide (PubChem CID 59990899) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide.
| Compound Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 59990899 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (1R,8S)-6-[(2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-N,N-dipropyl-2,3-dihydro-1H-pyrrolizine-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)[C@@H]1CCN2C(=O)C(C(=O)C3[C@H]4CCCC[C@@H]4C=C[C@@H]3C)=C[C@]12O |
| InChI | InChI=1S/C26H38N2O4/c1-4-13-27(14-5-2)25(31)21-12-15-28-24(30)20(16-26(21,28)32)23(29)22-17(3)10-11-18-8-6-7-9-19(18)22/h10-11,16-19,21-22,32H,4-9,12-15H2,1-3H3/t17-,18+,19-,21-,22?,26-/m0/s1 |
| InChIKey | SMDOFZOIWNOYNZ-QZIUGTAVSA-N |
| XLogP | 3.31 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|