C20H19ClFNO3 — CID 60576018
(E)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 60576018) has the molecular formula C20H19ClFNO3 and a molecular weight of 375.83 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60576018 |
| Molecular Formula | C20H19ClFNO3 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (E)-N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)Nc1cc(Cl)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C20H19ClFNO3/c21-15-7-8-19(26-13-17-5-2-10-25-17)18(12-15)23-20(24)9-6-14-3-1-4-16(22)11-14/h1,3-4,6-9,11-12,17H,2,5,10,13H2,(H,23,24)/b9-6+ |
| InChIKey | IEDSIAQMNZHKMP-RMKNXTFCSA-N |
| XLogP | 4.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|