C22H24ClNO4 — CID 76869519
N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 76869519) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 76869519 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1C=CC(=O)Nc1cc(Cl)ccc1OCC1CCCO1 |
| InChI | InChI=1S/C22H24ClNO4/c1-2-26-20-8-4-3-6-16(20)9-12-22(25)24-19-14-17(23)10-11-21(19)28-15-18-7-5-13-27-18/h3-4,6,8-12,14,18H,2,5,7,13,15H2,1H3,(H,24,25) |
| InChIKey | LCWQGBVTDPVHHZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|