C14H14N4 — CID 6087223
N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-1H-benzimidazol-2-amine (PubChem CID 6087223) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 6087223 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-[(Z)-6-bicyclo[3.2.0]hept-3-enylideneamino]-1H-benzimidazol-2-amine |
| SMILES | C1=CC2/C(=N\Nc3nc4ccccc4[nH]3)CC2C1 |
| InChI | InChI=1S/C14H14N4/c1-2-7-12-11(6-1)15-14(16-12)18-17-13-8-9-4-3-5-10(9)13/h1-3,5-7,9-10H,4,8H2,(H2,15,16,18)/b17-13- |
| InChIKey | SSDXASMVKDBABN-LGMDPLHJSA-N |
| XLogP | 2.93 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|