C17H16N4 — CID 4171111
N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-benzimidazol-2-amine (PubChem CID 4171111) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-benzimidazol-2-amine.
| Compound Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 4171111 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(3,4-dihydro-2H-naphthalen-1-ylideneamino)-1H-benzimidazol-2-amine |
| SMILES | c1ccc2c(c1)CCCC2=NNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H16N4/c1-2-8-13-12(6-1)7-5-11-14(13)20-21-17-18-15-9-3-4-10-16(15)19-17/h1-4,6,8-10H,5,7,11H2,(H2,18,19,21) |
| InChIKey | GATNWZZDQIZSHS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|