C18H30N2O — CID 63524867
2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]butanimidamide (PubChem CID 63524867) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]butanimidamide.
| Compound Name | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]butanimidamide |
|---|---|
| PubChem CID | 63524867 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]butanimidamide |
| SMILES | [H]/N=C(\N)C(CC)Oc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O/c1-7-15(16(19)20)21-14-10-8-13(9-11-14)18(5,6)12-17(2,3)4/h8-11,15H,7,12H2,1-6H3,(H3,19,20) |
| InChIKey | CYQXDKQISHLEKH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|