C8H13NO4S — CID 65171066
4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]thiazine-2-carboxylic acid (PubChem CID 65171066) has the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. Its IUPAC name is 4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]thiazine-2-carboxylic acid.
| Compound Name | 4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]thiazine-2-carboxylic acid |
|---|---|
| PubChem CID | 65171066 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrano[3,4-b][1,4]thiazine-2-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)C2COCCC2N1 |
| InChI | InChI=1S/C8H13NO4S/c10-8(11)6-4-14(12)7-3-13-2-1-5(7)9-6/h5-7,9H,1-4H2,(H,10,11) |
| InChIKey | PZHQFZJXVAJRQU-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |