C6H10N4O — CID 66157986
N-amino-N',5-dimethyl-1,2-oxazole-3-carboximidamide (PubChem CID 66157986) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is N-amino-N',5-dimethyl-1,2-oxazole-3-carboximidamide.
| Compound Name | N-amino-N',5-dimethyl-1,2-oxazole-3-carboximidamide |
|---|---|
| PubChem CID | 66157986 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N-amino-N',5-dimethyl-1,2-oxazole-3-carboximidamide |
| SMILES | C/N=C(\NN)c1cc(C)on1 |
| InChI | InChI=1S/C6H10N4O/c1-4-3-5(10-11-4)6(8-2)9-7/h3H,7H2,1-2H3,(H,8,9) |
| InChIKey | ITMNJIRDTXMRCO-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|