C20H21O7P — CID 66601082
2-[4-(diethylphosphorylmethoxy)phenyl]-3,5,7-trihydroxychromen-4-one (PubChem CID 66601082) has the molecular formula C20H21O7P and a molecular weight of 404.36 g/mol. Its IUPAC name is 2-[4-(diethylphosphorylmethoxy)phenyl]-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-[4-(diethylphosphorylmethoxy)phenyl]-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 66601082 |
| Molecular Formula | C20H21O7P |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[4-(diethylphosphorylmethoxy)phenyl]-3,5,7-trihydroxychromen-4-one |
| SMILES | CCP(=O)(CC)COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
| InChI | InChI=1S/C20H21O7P/c1-3-28(25,4-2)11-26-14-7-5-12(6-8-14)20-19(24)18(23)17-15(22)9-13(21)10-16(17)27-20/h5-10,21-22,24H,3-4,11H2,1-2H3 |
| InChIKey | IWJMEZQDXQUEED-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|