C35H39F2N5O5 — CID 66669369
1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide (PubChem CID 66669369) has the molecular formula C35H39F2N5O5 and a molecular weight of 647.72 g/mol. Its IUPAC name is 1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 66669369 |
| Molecular Formula | C35H39F2N5O5 |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | 1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinazolin-4-yl]oxy-3-fluorophenyl]-1-N'-(4-fluorophenyl)-2,2-dimethylcyclopropane-1,1-dicarboxamide |
| SMILES | CCN(CC)CCCOc1cc2ncnc(Oc3ccc(N(C(=O)C4(C(N)=O)CC4(C)C)c4ccc(F)cc4)cc3F)c2cc1OC |
| InChI | InChI=1S/C35H39F2N5O5/c1-6-41(7-2)15-8-16-46-30-19-27-25(18-29(30)45-5)31(40-21-39-27)47-28-14-13-24(17-26(28)37)42(23-11-9-22(36)10-12-23)33(44)35(32(38)43)20-34(35,3)4/h9-14,17-19,21H,6-8,15-16,20H2,1-5H3,(H2,38,43) |
| InChIKey | DLNHWPKLVVNQCG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|