C17H26Cl2N2O5 — CID 66782833
2-(3,4-dichloroanilino)-N-(3,4-dihydroxybutyl)-N-(2,2-dimethoxyethyl)propanamide (PubChem CID 66782833) has the molecular formula C17H26Cl2N2O5 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-N-(3,4-dihydroxybutyl)-N-(2,2-dimethoxyethyl)propanamide.
| Compound Name | 2-(3,4-dichloroanilino)-N-(3,4-dihydroxybutyl)-N-(2,2-dimethoxyethyl)propanamide |
|---|---|
| PubChem CID | 66782833 |
| Molecular Formula | C17H26Cl2N2O5 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-(3,4-dichloroanilino)-N-(3,4-dihydroxybutyl)-N-(2,2-dimethoxyethyl)propanamide |
| SMILES | COC(CN(CCC(O)CO)C(=O)C(C)Nc1ccc(Cl)c(Cl)c1)OC |
| InChI | InChI=1S/C17H26Cl2N2O5/c1-11(20-12-4-5-14(18)15(19)8-12)17(24)21(7-6-13(23)10-22)9-16(25-2)26-3/h4-5,8,11,13,16,20,22-23H,6-7,9-10H2,1-3H3 |
| InChIKey | XANBMEYVSOYHQE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|