C25H25ClN4O4 — CID 67212139
benzyl 3-(butoxycarbonylamino)-3-[5-chloro-4-(4-cyanophenyl)-1H-imidazol-2-yl]propanoate (PubChem CID 67212139) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is benzyl 3-(butoxycarbonylamino)-3-[5-chloro-4-(4-cyanophenyl)-1H-imidazol-2-yl]propanoate.
| Compound Name | benzyl 3-(butoxycarbonylamino)-3-[5-chloro-4-(4-cyanophenyl)-1H-imidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 67212139 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | benzyl 3-(butoxycarbonylamino)-3-[5-chloro-4-(4-cyanophenyl)-1H-imidazol-2-yl]propanoate |
| SMILES | CCCCOC(=O)NC(CC(=O)OCc1ccccc1)c1nc(-c2ccc(C#N)cc2)c(Cl)[nH]1 |
| InChI | InChI=1S/C25H25ClN4O4/c1-2-3-13-33-25(32)28-20(14-21(31)34-16-18-7-5-4-6-8-18)24-29-22(23(26)30-24)19-11-9-17(15-27)10-12-19/h4-12,20H,2-3,13-14,16H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | LNVOXQOXBNRSHB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|