C20H37Cl2N5 — CID 67333913
2-benzyl-1-carbamimidoyl-3-decyl-1-methylguanidine;dihydrochloride (PubChem CID 67333913) has the molecular formula C20H37Cl2N5 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-benzyl-1-carbamimidoyl-3-decyl-1-methylguanidine;dihydrochloride.
| Compound Name | 2-benzyl-1-carbamimidoyl-3-decyl-1-methylguanidine;dihydrochloride |
|---|---|
| PubChem CID | 67333913 |
| Molecular Formula | C20H37Cl2N5 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 2-benzyl-1-carbamimidoyl-3-decyl-1-methylguanidine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N(C)/C(=N/Cc1ccccc1)NCCCCCCCCCC |
| InChI | InChI=1S/C20H35N5.2ClH/c1-3-4-5-6-7-8-9-13-16-23-20(25(2)19(21)22)24-17-18-14-11-10-12-15-18;;/h10-12,14-15H,3-9,13,16-17H2,1-2H3,(H3,21,22)(H,23,24);2*1H |
| InChIKey | MTIXNTXUJFZSOO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|