C11H8ClNO2S — CID 67450079
3-oxo-5H-thieno[2,3-c]quinolin-4-one;hydrochloride (PubChem CID 67450079) has the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. Its IUPAC name is 3-oxo-5H-thieno[2,3-c]quinolin-4-one;hydrochloride.
| Compound Name | 3-oxo-5H-thieno[2,3-c]quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 67450079 |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 3-oxo-5H-thieno[2,3-c]quinolin-4-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2ccccc2c2c1S(=O)C=C2 |
| InChI | InChI=1S/C11H7NO2S.ClH/c13-11-10-8(5-6-15(10)14)7-3-1-2-4-9(7)12-11;/h1-6H,(H,12,13);1H |
| InChIKey | FGJADYXLISKSBK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |