C29H34FNO7 — CID 67461628
2-[5-fluoro-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]-4-oxo-8-propoxyquinolin-1-yl]butanoic acid (PubChem CID 67461628) has the molecular formula C29H34FNO7 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-[5-fluoro-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]-4-oxo-8-propoxyquinolin-1-yl]butanoic acid.
| Compound Name | 2-[5-fluoro-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]-4-oxo-8-propoxyquinolin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 67461628 |
| Molecular Formula | C29H34FNO7 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 2-[5-fluoro-3-[4-[2-(oxan-2-yloxy)ethoxy]phenyl]-4-oxo-8-propoxyquinolin-1-yl]butanoic acid |
| SMILES | CCCOc1ccc(F)c2c(=O)c(-c3ccc(OCCOC4CCCCO4)cc3)cn(C(CC)C(=O)O)c12 |
| InChI | InChI=1S/C29H34FNO7/c1-3-14-36-24-13-12-22(30)26-27(24)31(23(4-2)29(33)34)18-21(28(26)32)19-8-10-20(11-9-19)35-16-17-38-25-7-5-6-15-37-25/h8-13,18,23,25H,3-7,14-17H2,1-2H3,(H,33,34) |
| InChIKey | DQDOKVZMNHAPPY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|