C14H9N5O2S — CID 67591169
11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylic acid (PubChem CID 67591169) has the molecular formula C14H9N5O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylic acid.
| Compound Name | 11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylic acid |
|---|---|
| PubChem CID | 67591169 |
| Molecular Formula | C14H9N5O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 11-(1,2,4-triazol-1-ylmethyl)-8-thia-4,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene-12-carboxylic acid |
| SMILES | O=C(O)c1cc2c(nc1Cn1cncn1)sc1ccncc12 |
| InChI | InChI=1S/C14H9N5O2S/c20-14(21)9-3-8-10-4-15-2-1-12(10)22-13(8)18-11(9)5-19-7-16-6-17-19/h1-4,6-7H,5H2,(H,20,21) |
| InChIKey | UWGVWTFMKDBLPC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |