C25H27NO4 — CID 67619399
3-amino-3,4-diphenyl-1-(3,4,5-trimethoxyphenyl)butan-1-one (PubChem CID 67619399) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 3-amino-3,4-diphenyl-1-(3,4,5-trimethoxyphenyl)butan-1-one.
| Compound Name | 3-amino-3,4-diphenyl-1-(3,4,5-trimethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 67619399 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-amino-3,4-diphenyl-1-(3,4,5-trimethoxyphenyl)butan-1-one |
| SMILES | COc1cc(C(=O)CC(N)(Cc2ccccc2)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO4/c1-28-22-14-19(15-23(29-2)24(22)30-3)21(27)17-25(26,20-12-8-5-9-13-20)16-18-10-6-4-7-11-18/h4-15H,16-17,26H2,1-3H3 |
| InChIKey | ATKJNFSMUNLTRJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |