C10H10O6 — CID 67638779
2-(carboxymethoxy)-2-(2-hydroxyphenyl)acetic acid (PubChem CID 67638779) has the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. Its IUPAC name is 2-(carboxymethoxy)-2-(2-hydroxyphenyl)acetic acid.
| Compound Name | 2-(carboxymethoxy)-2-(2-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 67638779 |
| Molecular Formula | C10H10O6 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(carboxymethoxy)-2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)COC(C(=O)O)c1ccccc1O |
| InChI | InChI=1S/C10H10O6/c11-7-4-2-1-3-6(7)9(10(14)15)16-5-8(12)13/h1-4,9,11H,5H2,(H,12,13)(H,14,15) |
| InChIKey | LGYHRWHYCZZKGT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |