C16H16NNa2O9P — CID 67652291
disodium;[1-(4,5-dimethoxy-2-nitrophenyl)-2-(2-hydroxyphenyl)ethyl] phosphate (PubChem CID 67652291) has the molecular formula C16H16NNa2O9P and a molecular weight of 443.26 g/mol. Its IUPAC name is disodium;[1-(4,5-dimethoxy-2-nitrophenyl)-2-(2-hydroxyphenyl)ethyl] phosphate.
| Compound Name | disodium;[1-(4,5-dimethoxy-2-nitrophenyl)-2-(2-hydroxyphenyl)ethyl] phosphate |
|---|---|
| PubChem CID | 67652291 |
| Molecular Formula | C16H16NNa2O9P |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | disodium;[1-(4,5-dimethoxy-2-nitrophenyl)-2-(2-hydroxyphenyl)ethyl] phosphate |
| SMILES | COc1cc(C(Cc2ccccc2O)OP(=O)([O-])[O-])c([N+](=O)[O-])cc1OC.[Na+].[Na+] |
| InChI | InChI=1S/C16H18NO9P.2Na/c1-24-15-8-11(12(17(19)20)9-16(15)25-2)14(26-27(21,22)23)7-10-5-3-4-6-13(10)18;;/h3-6,8-9,14,18H,7H2,1-2H3,(H2,21,22,23);;/q;2*+1/p-2 |
| InChIKey | PHVMXUAUQBSBLG-UHFFFAOYSA-L |
| XLogP | -4.55 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|