C28H48N4O6 — CID 67671661
tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-2-ylpentyl]carbamate (PubChem CID 67671661) has the molecular formula C28H48N4O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-2-ylpentyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-2-ylpentyl]carbamate |
|---|---|
| PubChem CID | 67671661 |
| Molecular Formula | C28H48N4O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | tert-butyl N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-2-ylpentyl]carbamate |
| SMILES | CC(c1ccccn1)C(CCN(CCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H48N4O6/c1-20(21-14-11-12-16-29-21)22(31-24(34)37-27(5,6)7)15-19-32(25(35)38-28(8,9)10)18-13-17-30-23(33)36-26(2,3)4/h11-12,14,16,20,22H,13,15,17-19H2,1-10H3,(H,30,33)(H,31,34) |
| InChIKey | QYVCKUAQVMPHRT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|