C27H46N6O5S — CID 67701146
2-amino-N-[(2S)-1-[[(2S)-3-cyclohexyl-1-hydroxy-1-(4-methylphenyl)sulfonylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 67701146) has the molecular formula C27H46N6O5S and a molecular weight of 566.77 g/mol. Its IUPAC name is 2-amino-N-[(2S)-1-[[(2S)-3-cyclohexyl-1-hydroxy-1-(4-methylphenyl)sulfonylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-amino-N-[(2S)-1-[[(2S)-3-cyclohexyl-1-hydroxy-1-(4-methylphenyl)sulfonylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 67701146 |
| Molecular Formula | C27H46N6O5S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 2-amino-N-[(2S)-1-[[(2S)-3-cyclohexyl-1-hydroxy-1-(4-methylphenyl)sulfonylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | Cc1ccc(S(=O)(=O)C(O)[C@H](CC2CCCCC2)NC(=O)[C@@H](NC(=O)C(N)CCCN=C(N)N)C(C)C)cc1 |
| InChI | InChI=1S/C27H46N6O5S/c1-17(2)23(33-24(34)21(28)10-7-15-31-27(29)30)25(35)32-22(16-19-8-5-4-6-9-19)26(36)39(37,38)20-13-11-18(3)12-14-20/h11-14,17,19,21-23,26,36H,4-10,15-16,28H2,1-3H3,(H,32,35)(H,33,34)(H4,29,30,31)/t21?,22-,23-,26?/m0/s1 |
| InChIKey | AFGZGOPBAGQZNF-ZQFKLAOWSA-N |
| XLogP | 1.06 |
| TPSA | 202.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|