C35H45NO5 — CID 67847016
[4-[1-[4-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate (PubChem CID 67847016) has the molecular formula C35H45NO5 and a molecular weight of 559.75 g/mol. Its IUPAC name is [4-[1-[4-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[1-[4-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67847016 |
| Molecular Formula | C35H45NO5 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | [4-[1-[4-[3-(diethylamino)-2-hydroxypropoxy]phenyl]-2-phenylbut-1-enyl]phenoxy]methyl 2,2-dimethylpropanoate |
| SMILES | CCC(=C(c1ccc(OCOC(=O)C(C)(C)C)cc1)c1ccc(OCC(O)CN(CC)CC)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H45NO5/c1-7-32(26-13-11-10-12-14-26)33(28-17-21-31(22-18-28)40-25-41-34(38)35(4,5)6)27-15-19-30(20-16-27)39-24-29(37)23-36(8-2)9-3/h10-22,29,37H,7-9,23-25H2,1-6H3 |
| InChIKey | IDXVETWDKFZSHD-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|