C34H38F2O — CID 67861675
1-(4-ethoxy-4-octylcyclohexa-1,5-dien-1-yl)-2,3-difluoro-4-(4-phenylphenyl)benzene (PubChem CID 67861675) has the molecular formula C34H38F2O and a molecular weight of 500.67 g/mol. Its IUPAC name is 1-(4-ethoxy-4-octylcyclohexa-1,5-dien-1-yl)-2,3-difluoro-4-(4-phenylphenyl)benzene.
| Compound Name | 1-(4-ethoxy-4-octylcyclohexa-1,5-dien-1-yl)-2,3-difluoro-4-(4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 67861675 |
| Molecular Formula | C34H38F2O |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 1-(4-ethoxy-4-octylcyclohexa-1,5-dien-1-yl)-2,3-difluoro-4-(4-phenylphenyl)benzene |
| SMILES | CCCCCCCCC1(OCC)C=CC(c2ccc(-c3ccc(-c4ccccc4)cc3)c(F)c2F)=CC1 |
| InChI | InChI=1S/C34H38F2O/c1-3-5-6-7-8-12-23-34(37-4-2)24-21-29(22-25-34)31-20-19-30(32(35)33(31)36)28-17-15-27(16-18-28)26-13-10-9-11-14-26/h9-11,13-22,24H,3-8,12,23,25H2,1-2H3 |
| InChIKey | JBKBXRHDQRIPTB-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|