C22H15Cl2FN2O3S — CID 68514980
[4-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]phenyl] carbamate (PubChem CID 68514980) has the molecular formula C22H15Cl2FN2O3S and a molecular weight of 477.34 g/mol. Its IUPAC name is [4-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]phenyl] carbamate.
| Compound Name | [4-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]phenyl] carbamate |
|---|---|
| PubChem CID | 68514980 |
| Molecular Formula | C22H15Cl2FN2O3S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [4-[6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-1,3-benzothiazol-2-yl]phenyl] carbamate |
| SMILES | CC(Oc1ccc2nc(-c3ccc(OC(N)=O)cc3)sc2c1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H15Cl2FN2O3S/c1-11(19-15(23)7-8-16(25)20(19)24)29-14-6-9-17-18(10-14)31-21(27-17)12-2-4-13(5-3-12)30-22(26)28/h2-11H,1H3,(H2,26,28) |
| InChIKey | CHXKIVCKJCPNED-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|