C19H19ClO3S2 — CID 68726658
5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-(2-thiophen-2-ylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid (PubChem CID 68726658) has the molecular formula C19H19ClO3S2 and a molecular weight of 394.95 g/mol. Its IUPAC name is 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-(2-thiophen-2-ylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-(2-thiophen-2-ylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68726658 |
| Molecular Formula | C19H19ClO3S2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-[3-[(1R,2S,3R,5S)-5-chloro-3-hydroxy-2-(2-thiophen-2-ylethynyl)cyclopentyl]propyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCC[C@@H]2[C@@H](C#Cc3cccs3)[C@H](O)C[C@@H]2Cl)s1 |
| InChI | InChI=1S/C19H19ClO3S2/c20-16-11-17(21)15(8-6-12-4-2-10-24-12)14(16)5-1-3-13-7-9-18(25-13)19(22)23/h2,4,7,9-10,14-17,21H,1,3,5,11H2,(H,22,23)/t14-,15-,16+,17-/m1/s1 |
| InChIKey | PVDNYUSNELXNOS-WCXIOVBPSA-N |
| XLogP | 4.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|