C10H9N3O2S2 — CID 68942872
3-(1,3-thiazol-2-yl)-2-(1,3-thiazol-2-ylmethylideneamino)propanoic acid (PubChem CID 68942872) has the molecular formula C10H9N3O2S2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)-2-(1,3-thiazol-2-ylmethylideneamino)propanoic acid.
| Compound Name | 3-(1,3-thiazol-2-yl)-2-(1,3-thiazol-2-ylmethylideneamino)propanoic acid |
|---|---|
| PubChem CID | 68942872 |
| Molecular Formula | C10H9N3O2S2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)-2-(1,3-thiazol-2-ylmethylideneamino)propanoic acid |
| SMILES | O=C(O)C(Cc1nccs1)/N=C/c1nccs1 |
| InChI | InChI=1S/C10H9N3O2S2/c14-10(15)7(5-8-11-1-3-16-8)13-6-9-12-2-4-17-9/h1-4,6-7H,5H2,(H,14,15)/b13-6+ |
| InChIKey | SQAJWMWJQMZVIC-AWNIVKPZSA-N |
| XLogP | 1.71 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|