C28H40BrNO2 — CID 68959736
(1S)-1-[4-bromo-2-(3-methylphenyl)phenyl]-1-[(3R)-1-tert-butylpiperidin-3-yl]-5-methoxypentan-1-ol (PubChem CID 68959736) has the molecular formula C28H40BrNO2 and a molecular weight of 502.54 g/mol. Its IUPAC name is (1S)-1-[4-bromo-2-(3-methylphenyl)phenyl]-1-[(3R)-1-tert-butylpiperidin-3-yl]-5-methoxypentan-1-ol.
| Compound Name | (1S)-1-[4-bromo-2-(3-methylphenyl)phenyl]-1-[(3R)-1-tert-butylpiperidin-3-yl]-5-methoxypentan-1-ol |
|---|---|
| PubChem CID | 68959736 |
| Molecular Formula | C28H40BrNO2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (1S)-1-[4-bromo-2-(3-methylphenyl)phenyl]-1-[(3R)-1-tert-butylpiperidin-3-yl]-5-methoxypentan-1-ol |
| SMILES | COCCCC[C@@](O)(c1ccc(Br)cc1-c1cccc(C)c1)[C@@H]1CCCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C28H40BrNO2/c1-21-10-8-11-22(18-21)25-19-24(29)13-14-26(25)28(31,15-6-7-17-32-5)23-12-9-16-30(20-23)27(2,3)4/h8,10-11,13-14,18-19,23,31H,6-7,9,12,15-17,20H2,1-5H3/t23-,28+/m1/s1 |
| InChIKey | BXYXHUYJCNPQTL-LXFBAYGMSA-N |
| XLogP | 6.94 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|