C14H18N3O4S2- — CID 69031340
2-[2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]ethyl-sulfinatoamino]-1,3-benzothiazole (PubChem CID 69031340) has the molecular formula C14H18N3O4S2- and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]ethyl-sulfinatoamino]-1,3-benzothiazole.
| Compound Name | 2-[2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]ethyl-sulfinatoamino]-1,3-benzothiazole |
|---|---|
| PubChem CID | 69031340 |
| Molecular Formula | C14H18N3O4S2- |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[2-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]ethyl-sulfinatoamino]-1,3-benzothiazole |
| SMILES | CCOC(=O)[C@H](C)NCCN(c1nc2ccccc2s1)S(=O)[O-] |
| InChI | InChI=1S/C14H19N3O4S2/c1-3-21-13(18)10(2)15-8-9-17(23(19)20)14-16-11-6-4-5-7-12(11)22-14/h4-7,10,15H,3,8-9H2,1-2H3,(H,19,20)/p-1/t10-/m0/s1 |
| InChIKey | DFHSXOYYYJRKLC-JTQLQIEISA-M |
| XLogP | 1.44 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|