C24H29N3O4 — CID 69146440
but-2-enedioic acid;N-[4-[[4-(2-methylpropyl)phenyl]methyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 69146440) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is but-2-enedioic acid;N-[4-[[4-(2-methylpropyl)phenyl]methyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | but-2-enedioic acid;N-[4-[[4-(2-methylpropyl)phenyl]methyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 69146440 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | but-2-enedioic acid;N-[4-[[4-(2-methylpropyl)phenyl]methyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC(C)Cc1ccc(Cc2ccc(NC3=NCCN3)cc2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H25N3.C4H4O4/c1-15(2)13-16-3-5-17(6-4-16)14-18-7-9-19(10-8-18)23-20-21-11-12-22-20;5-3(6)1-2-4(7)8/h3-10,15H,11-14H2,1-2H3,(H2,21,22,23);1-2H,(H,5,6)(H,7,8) |
| InChIKey | HDUZAAGCOXVJOA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|